C13H9N3O8 — CID 88521091
[4-(4-hydroxyanilino)-3,5-dinitrophenyl] hydrogen carbonate (PubChem CID 88521091) has the molecular formula C13H9N3O8 and a molecular weight of 335.23 g/mol. Its IUPAC name is [4-(4-hydroxyanilino)-3,5-dinitrophenyl] hydrogen carbonate.
| Compound Name | [4-(4-hydroxyanilino)-3,5-dinitrophenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 88521091 |
| Molecular Formula | C13H9N3O8 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | [4-(4-hydroxyanilino)-3,5-dinitrophenyl] hydrogen carbonate |
| SMILES | O=C(O)Oc1cc([N+](=O)[O-])c(Nc2ccc(O)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H9N3O8/c17-8-3-1-7(2-4-8)14-12-10(15(20)21)5-9(24-13(18)19)6-11(12)16(22)23/h1-6,14,17H,(H,18,19) |
| InChIKey | JAPYSIWWPHIYBQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 165.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|