C31H22N4O8 — CID 23857665
[4-[4-(benzylcarbamoyl)-2,6-dinitroanilino]phenyl] 3-hydroxynaphthalene-2-carboxylate (PubChem CID 23857665) has the molecular formula C31H22N4O8 and a molecular weight of 578.54 g/mol. Its IUPAC name is [4-[4-(benzylcarbamoyl)-2,6-dinitroanilino]phenyl] 3-hydroxynaphthalene-2-carboxylate.
| Compound Name | [4-[4-(benzylcarbamoyl)-2,6-dinitroanilino]phenyl] 3-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 23857665 |
| Molecular Formula | C31H22N4O8 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | [4-[4-(benzylcarbamoyl)-2,6-dinitroanilino]phenyl] 3-hydroxynaphthalene-2-carboxylate |
| SMILES | O=C(NCc1ccccc1)c1cc([N+](=O)[O-])c(Nc2ccc(OC(=O)c3cc4ccccc4cc3O)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C31H22N4O8/c36-28-17-21-9-5-4-8-20(21)14-25(28)31(38)43-24-12-10-23(11-13-24)33-29-26(34(39)40)15-22(16-27(29)35(41)42)30(37)32-18-19-6-2-1-3-7-19/h1-17,33,36H,18H2,(H,32,37) |
| InChIKey | ADOQWKZZJQNDKF-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 173.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|