C17H15N5O5 — CID 5209185
benzimidazol-1-yl-[3,5-dinitro-4-(propan-2-ylamino)phenyl]methanone (PubChem CID 5209185) has the molecular formula C17H15N5O5 and a molecular weight of 369.34 g/mol. Its IUPAC name is benzimidazol-1-yl-[3,5-dinitro-4-(propan-2-ylamino)phenyl]methanone.
| Compound Name | benzimidazol-1-yl-[3,5-dinitro-4-(propan-2-ylamino)phenyl]methanone |
|---|---|
| PubChem CID | 5209185 |
| Molecular Formula | C17H15N5O5 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | benzimidazol-1-yl-[3,5-dinitro-4-(propan-2-ylamino)phenyl]methanone |
| SMILES | CC(C)Nc1c([N+](=O)[O-])cc(C(=O)n2cnc3ccccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15N5O5/c1-10(2)19-16-14(21(24)25)7-11(8-15(16)22(26)27)17(23)20-9-18-12-5-3-4-6-13(12)20/h3-10,19H,1-2H3 |
| InChIKey | CCDBEKYPHMTDRU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|