About 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one
4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 12005126) has the molecular formula C23H19N5O6
and a molecular weight of 461.43 g/mol. Its IUPAC name is 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one.
Molecular Properties
| Compound Name | 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one |
| PubChem CID | 12005126 |
| Molecular Formula | C23H19N5O6 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | CCc1cccc(Nc2c([N+](=O)[O-])cc(C(=O)N3CC(=O)Nc4ccccc43)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H19N5O6/c1-2-14-6-5-7-16(10-14)24-22-19(27(31)32)11-15(12-20(22)28(33)34)23(30)26-13-21(29)25-17-8-3-4-9-18(17)26/h3-12,24H,2,13H2,1H3,(H,25,29) |
| InChIKey | KATQEEQUEXSPBX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one?
The IUPAC name of 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one (CID 12005126) is 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one.
What is the SMILES notation for 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one?
The canonical SMILES for 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one is CCc1cccc(Nc2c([N+](=O)[O-])cc(C(=O)N3CC(=O)Nc4ccccc43)cc2[N+](=O)[O-])c1.
What is the InChIKey of 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one?
The InChIKey is KATQEEQUEXSPBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19N5O6/c1-2-14-6-5-7-16(10-14)24-22-19(27(31)32)11-15(12-20(22)28(33)34)23(30)26-13-21(29)25-17-8-3-4-9-18(17)26/h3-12,24H,2,13H2,1H3,(H,25,29).
What are the key properties of 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one?
4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one has a molecular weight of 461.43 g/mol, XLogP of 4.41, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3-ethylanilino)-3,5-dinitrobenzoyl]-1,3-dihydroquinoxalin-2-one is sourced from PubChem (CID 12005126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).