C25H17N5O7 — CID 55750725
2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]acetamide (PubChem CID 55750725) has the molecular formula C25H17N5O7 and a molecular weight of 499.44 g/mol. Its IUPAC name is 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]acetamide.
| Compound Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55750725 |
| Molecular Formula | C25H17N5O7 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 2-(4-nitro-1,3-dioxoisoindol-2-yl)-N-[4-(3-oxo-2,4-dihydroquinoxaline-1-carbonyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)Nc1ccc(C(=O)N2CC(=O)Nc3ccccc32)cc1 |
| InChI | InChI=1S/C25H17N5O7/c31-20(13-29-24(34)16-4-3-7-19(30(36)37)22(16)25(29)35)26-15-10-8-14(9-11-15)23(33)28-12-21(32)27-17-5-1-2-6-18(17)28/h1-11H,12-13H2,(H,26,31)(H,27,32) |
| InChIKey | JMPDWNUZRVBDQY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|