C22H18N4O7 — CID 5241640
3-[[4-(2,4-dimethylanilino)-3,5-dinitrobenzoyl]amino]benzoic acid (PubChem CID 5241640) has the molecular formula C22H18N4O7 and a molecular weight of 450.41 g/mol. Its IUPAC name is 3-[[4-(2,4-dimethylanilino)-3,5-dinitrobenzoyl]amino]benzoic acid.
| Compound Name | 3-[[4-(2,4-dimethylanilino)-3,5-dinitrobenzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 5241640 |
| Molecular Formula | C22H18N4O7 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 3-[[4-(2,4-dimethylanilino)-3,5-dinitrobenzoyl]amino]benzoic acid |
| SMILES | Cc1ccc(Nc2c([N+](=O)[O-])cc(C(=O)Nc3cccc(C(=O)O)c3)cc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C22H18N4O7/c1-12-6-7-17(13(2)8-12)24-20-18(25(30)31)10-15(11-19(20)26(32)33)21(27)23-16-5-3-4-14(9-16)22(28)29/h3-11,24H,1-2H3,(H,23,27)(H,28,29) |
| InChIKey | WJPJMXAJAZHZIH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 164.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|