C27H25N7O9S — CID 5241635
N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-4-(2,4-dimethylanilino)-3,5-dinitrobenzamide (PubChem CID 5241635) has the molecular formula C27H25N7O9S and a molecular weight of 623.60 g/mol. Its IUPAC name is N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-4-(2,4-dimethylanilino)-3,5-dinitrobenzamide.
| Compound Name | N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-4-(2,4-dimethylanilino)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 5241635 |
| Molecular Formula | C27H25N7O9S |
| Molecular Weight | 623.60 g/mol |
| Exact Mass | 623.14 |
| IUPAC Name | N-[4-[(2,6-dimethoxypyrimidin-4-yl)sulfamoyl]phenyl]-4-(2,4-dimethylanilino)-3,5-dinitrobenzamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=O)c3cc([N+](=O)[O-])c(Nc4ccc(C)cc4C)c([N+](=O)[O-])c3)cc2)nc(OC)n1 |
| InChI | InChI=1S/C27H25N7O9S/c1-15-5-10-20(16(2)11-15)29-25-21(33(36)37)12-17(13-22(25)34(38)39)26(35)28-18-6-8-19(9-7-18)44(40,41)32-23-14-24(42-3)31-27(30-23)43-4/h5-14,29H,1-4H3,(H,28,35)(H,30,31,32) |
| InChIKey | JGUQYFVMYWXLOL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 217.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|