C12H15BrN2O2 — CID 168513229
1-(2-bromo-3,4-dimethyl-6-nitrophenyl)pyrrolidine (PubChem CID 168513229) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is 1-(2-bromo-3,4-dimethyl-6-nitrophenyl)pyrrolidine.
| Compound Name | 1-(2-bromo-3,4-dimethyl-6-nitrophenyl)pyrrolidine |
|---|---|
| PubChem CID | 168513229 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 1-(2-bromo-3,4-dimethyl-6-nitrophenyl)pyrrolidine |
| SMILES | Cc1cc([N+](=O)[O-])c(N2CCCC2)c(Br)c1C |
| InChI | InChI=1S/C12H15BrN2O2/c1-8-7-10(15(16)17)12(11(13)9(8)2)14-5-3-4-6-14/h7H,3-6H2,1-2H3 |
| InChIKey | NPFKDDDOADVBOF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|