C21H21NO4 — CID 159769323
6-[2-(3-morpholin-4-ylphenyl)ethyl]-1-benzofuran-2-carboxylic acid (PubChem CID 159769323) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 6-[2-(3-morpholin-4-ylphenyl)ethyl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 6-[2-(3-morpholin-4-ylphenyl)ethyl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 159769323 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 6-[2-(3-morpholin-4-ylphenyl)ethyl]-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)c1cc2ccc(CCc3cccc(N4CCOCC4)c3)cc2o1 |
| InChI | InChI=1S/C21H21NO4/c23-21(24)20-14-17-7-6-16(13-19(17)26-20)5-4-15-2-1-3-18(12-15)22-8-10-25-11-9-22/h1-3,6-7,12-14H,4-5,8-11H2,(H,23,24) |
| InChIKey | NFXISRKEXQAIOH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |