C19H17N3O4 — CID 47020558
N-(5-morpholin-4-yl-2-pyridinyl)-2-oxochromene-3-carboxamide (PubChem CID 47020558) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is N-(5-morpholin-4-yl-2-pyridinyl)-2-oxochromene-3-carboxamide.
| Compound Name | N-(5-morpholin-4-yl-2-pyridinyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 47020558 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | N-(5-morpholin-4-yl-2-pyridinyl)-2-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cn1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C19H17N3O4/c23-18(15-11-13-3-1-2-4-16(13)26-19(15)24)21-17-6-5-14(12-20-17)22-7-9-25-10-8-22/h1-6,11-12H,7-10H2,(H,20,21,23) |
| InChIKey | FXDHYNLHRGXACH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|