C17H18N2O5 — CID 94813486
N-[(2R)-1-morpholin-4-yl-1-oxopropan-2-yl]-2-oxochromene-3-carboxamide (PubChem CID 94813486) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is N-[(2R)-1-morpholin-4-yl-1-oxopropan-2-yl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[(2R)-1-morpholin-4-yl-1-oxopropan-2-yl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 94813486 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | N-[(2R)-1-morpholin-4-yl-1-oxopropan-2-yl]-2-oxochromene-3-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cc2ccccc2oc1=O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H18N2O5/c1-11(16(21)19-6-8-23-9-7-19)18-15(20)13-10-12-4-2-3-5-14(12)24-17(13)22/h2-5,10-11H,6-9H2,1H3,(H,18,20)/t11-/m1/s1 |
| InChIKey | KXHOTPNYXUCQRQ-LLVKDONJSA-N |
| XLogP | 0.77 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|