C18H20FN3O2 — CID 146084918
4-fluoro-3,5-dimethyl-N-(5-morpholin-4-yl-2-pyridinyl)benzamide (PubChem CID 146084918) has the molecular formula C18H20FN3O2 and a molecular weight of 329.38 g/mol. Its IUPAC name is 4-fluoro-3,5-dimethyl-N-(5-morpholin-4-yl-2-pyridinyl)benzamide.
| Compound Name | 4-fluoro-3,5-dimethyl-N-(5-morpholin-4-yl-2-pyridinyl)benzamide |
|---|---|
| PubChem CID | 146084918 |
| Molecular Formula | C18H20FN3O2 |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-fluoro-3,5-dimethyl-N-(5-morpholin-4-yl-2-pyridinyl)benzamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(N3CCOCC3)cn2)cc(C)c1F |
| InChI | InChI=1S/C18H20FN3O2/c1-12-9-14(10-13(2)17(12)19)18(23)21-16-4-3-15(11-20-16)22-5-7-24-8-6-22/h3-4,9-11H,5-8H2,1-2H3,(H,20,21,23) |
| InChIKey | RFXIISPKATYERF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |