C18H17N3O3 — CID 134053222
N-(5-morpholin-4-yl-2-pyridinyl)-1-benzofuran-2-carboxamide (PubChem CID 134053222) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-(5-morpholin-4-yl-2-pyridinyl)-1-benzofuran-2-carboxamide.
| Compound Name | N-(5-morpholin-4-yl-2-pyridinyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 134053222 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-(5-morpholin-4-yl-2-pyridinyl)-1-benzofuran-2-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cn1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C18H17N3O3/c22-18(16-11-13-3-1-2-4-15(13)24-16)20-17-6-5-14(12-19-17)21-7-9-23-10-8-21/h1-6,11-12H,7-10H2,(H,19,20,22) |
| InChIKey | NEHJYVHHIHXNQP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |