C15H17N3O3 — CID 118041590
N'-hydroxy-2-oxo-7-piperidin-1-ylchromene-3-carboximidamide (PubChem CID 118041590) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is N'-hydroxy-2-oxo-7-piperidin-1-ylchromene-3-carboximidamide.
| Compound Name | N'-hydroxy-2-oxo-7-piperidin-1-ylchromene-3-carboximidamide |
|---|---|
| PubChem CID | 118041590 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N'-hydroxy-2-oxo-7-piperidin-1-ylchromene-3-carboximidamide |
| SMILES | N/C(=N\O)c1cc2ccc(N3CCCCC3)cc2oc1=O |
| InChI | InChI=1S/C15H17N3O3/c16-14(17-20)12-8-10-4-5-11(9-13(10)21-15(12)19)18-6-2-1-3-7-18/h4-5,8-9,20H,1-3,6-7H2,(H2,16,17) |
| InChIKey | ISTNPLUMBQLLNI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 92.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|