C21H21N2O2+ — CID 87648903
3-(1-prop-2-enylpyridin-1-ium-4-yl)-7-pyrrolidin-1-ylchromen-2-one (PubChem CID 87648903) has the molecular formula C21H21N2O2+ and a molecular weight of 333.41 g/mol. Its IUPAC name is 3-(1-prop-2-enylpyridin-1-ium-4-yl)-7-pyrrolidin-1-ylchromen-2-one.
| Compound Name | 3-(1-prop-2-enylpyridin-1-ium-4-yl)-7-pyrrolidin-1-ylchromen-2-one |
|---|---|
| PubChem CID | 87648903 |
| Molecular Formula | C21H21N2O2+ |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 3-(1-prop-2-enylpyridin-1-ium-4-yl)-7-pyrrolidin-1-ylchromen-2-one |
| SMILES | C=CC[n+]1ccc(-c2cc3ccc(N4CCCC4)cc3oc2=O)cc1 |
| InChI | InChI=1S/C21H21N2O2/c1-2-9-22-12-7-16(8-13-22)19-14-17-5-6-18(23-10-3-4-11-23)15-20(17)25-21(19)24/h2,5-8,12-15H,1,3-4,9-11H2/q+1 |
| InChIKey | APVMNXXXIVCQAD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 37.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|