C33H35ClN2O9 — CID 71734545
[10-(diethylamino)-7-(2-ethoxycarbonylphenyl)-6-oxochromeno[3,2-c]chromen-3-ylidene]-diethylazanium perchlorate (PubChem CID 71734545) has the molecular formula C33H35ClN2O9 and a molecular weight of 639.10 g/mol. Its IUPAC name is [10-(diethylamino)-7-(2-ethoxycarbonylphenyl)-6-oxochromeno[3,2-c]chromen-3-ylidene]-diethylazanium perchlorate.
| Compound Name | [10-(diethylamino)-7-(2-ethoxycarbonylphenyl)-6-oxochromeno[3,2-c]chromen-3-ylidene]-diethylazanium perchlorate |
|---|---|
| PubChem CID | 71734545 |
| Molecular Formula | C33H35ClN2O9 |
| Molecular Weight | 639.10 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | [10-(diethylamino)-7-(2-ethoxycarbonylphenyl)-6-oxochromeno[3,2-c]chromen-3-ylidene]-diethylazanium perchlorate |
| SMILES | CCOC(=O)c1ccccc1-c1c2ccc(N(CC)CC)cc2oc2c1c(=O)oc1cc(=[N+](CC)CC)ccc12.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C33H35N2O5.ClHO4/c1-6-34(7-2)21-15-17-25-27(19-21)39-31-26-18-16-22(35(8-3)9-4)20-28(26)40-33(37)30(31)29(25)23-13-11-12-14-24(23)32(36)38-10-5;2-1(3,4)5/h11-20H,6-10H2,1-5H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | NVWNIJBPQNJHIA-UHFFFAOYSA-M |
| XLogP | 1.44 |
| TPSA | 168.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.10 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|