C42H51N4O8+ — CID 172541116
[9-[2-carboxy-4-methoxy-5-[13-(2-methoxyphenyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium (PubChem CID 172541116) has the molecular formula C42H51N4O8+ and a molecular weight of 739.89 g/mol. Its IUPAC name is [9-[2-carboxy-4-methoxy-5-[13-(2-methoxyphenyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [9-[2-carboxy-4-methoxy-5-[13-(2-methoxyphenyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 172541116 |
| Molecular Formula | C42H51N4O8+ |
| Molecular Weight | 739.89 g/mol |
| Exact Mass | 739.37 |
| IUPAC Name | [9-[2-carboxy-4-methoxy-5-[13-(2-methoxyphenyl)-1,4,10-trioxa-7,13-diazacyclopentadec-7-yl]phenyl]-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium |
| SMILES | COc1ccccc1N1CCOCCOCCN(c2cc(-c3c4ccc(=[N+](C)C)cc-4oc4cc(N(C)C)ccc34)c(C(=O)O)cc2OC)CCOCC1 |
| InChI | InChI=1S/C42H50N4O8/c1-43(2)29-11-13-31-38(25-29)54-39-26-30(44(3)4)12-14-32(39)41(31)33-27-36(40(50-6)28-34(33)42(47)48)46-17-20-51-19-15-45(16-21-52-23-24-53-22-18-46)35-9-7-8-10-37(35)49-5/h7-14,25-28H,15-24H2,1-6H3/p+1 |
| InChIKey | UQWVHRJZVGFWQJ-UHFFFAOYSA-O |
| XLogP | 5.39 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.89 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|