C28H29N2O5+ — CID 177369329
[6-(dimethylamino)-9-(2-methylperoxycarbonyl-5-propanoylphenyl)xanthen-3-ylidene]-dimethylazanium (PubChem CID 177369329) has the molecular formula C28H29N2O5+ and a molecular weight of 473.55 g/mol. Its IUPAC name is [6-(dimethylamino)-9-(2-methylperoxycarbonyl-5-propanoylphenyl)xanthen-3-ylidene]-dimethylazanium.
| Compound Name | [6-(dimethylamino)-9-(2-methylperoxycarbonyl-5-propanoylphenyl)xanthen-3-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 177369329 |
| Molecular Formula | C28H29N2O5+ |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | [6-(dimethylamino)-9-(2-methylperoxycarbonyl-5-propanoylphenyl)xanthen-3-ylidene]-dimethylazanium |
| SMILES | CCC(=O)c1ccc(C(=O)OOC)c(-c2c3ccc(=[N+](C)C)cc-3oc3cc(N(C)C)ccc23)c1 |
| InChI | InChI=1S/C28H29N2O5/c1-7-24(31)17-8-11-20(28(32)35-33-6)23(14-17)27-21-12-9-18(29(2)3)15-25(21)34-26-16-19(30(4)5)10-13-22(26)27/h8-16H,7H2,1-6H3/q+1 |
| InChIKey | REOSOVPBKUWYMZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|