C28H30N2O3 — CID 71206487
2-[3-butan-2-ylimino-6-(diethylamino)xanthen-9-yl]benzoic acid (PubChem CID 71206487) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[3-butan-2-ylimino-6-(diethylamino)xanthen-9-yl]benzoic acid.
| Compound Name | 2-[3-butan-2-ylimino-6-(diethylamino)xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 71206487 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 2-[3-butan-2-ylimino-6-(diethylamino)xanthen-9-yl]benzoic acid |
| SMILES | CCC(C)/N=c1\ccc2c(-c3ccccc3C(=O)O)c3ccc(N(CC)CC)cc3oc-2c1 |
| InChI | InChI=1S/C28H30N2O3/c1-5-18(4)29-19-12-14-23-25(16-19)33-26-17-20(30(6-2)7-3)13-15-24(26)27(23)21-10-8-9-11-22(21)28(31)32/h8-18H,5-7H2,1-4H3,(H,31,32)/b29-19+ |
| InChIKey | QTJWBQSEWUMGLZ-VUTHCHCSSA-N |
| XLogP | 6.45 |
| TPSA | 66.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|