C27H15FeO6 — CID 67068177
2-[2,3-bis(2-carboxylatophenyl)phenyl]benzoate;iron(3+) (PubChem CID 67068177) has the molecular formula C27H15FeO6 and a molecular weight of 491.26 g/mol. Its IUPAC name is 2-[2,3-bis(2-carboxylatophenyl)phenyl]benzoate;iron(3+).
| Compound Name | 2-[2,3-bis(2-carboxylatophenyl)phenyl]benzoate;iron(3+) |
|---|---|
| PubChem CID | 67068177 |
| Molecular Formula | C27H15FeO6 |
| Molecular Weight | 491.26 g/mol |
| Exact Mass | 491.02 |
| IUPAC Name | 2-[2,3-bis(2-carboxylatophenyl)phenyl]benzoate;iron(3+) |
| SMILES | O=C([O-])c1ccccc1-c1cccc(-c2ccccc2C(=O)[O-])c1-c1ccccc1C(=O)[O-].[Fe+3] |
| InChI | InChI=1S/C27H18O6.Fe/c28-25(29)21-11-4-1-8-16(21)18-14-7-15-19(17-9-2-5-12-22(17)26(30)31)24(18)20-10-3-6-13-23(20)27(32)33;/h1-15H,(H,28,29)(H,30,31)(H,32,33);/q;+3/p-3 |
| InChIKey | XEWBGJRFJPPXBY-UHFFFAOYSA-K |
| XLogP | 1.78 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|