C41H40N3O10S2+ — CID 153443735
[9-[2-[3-carboxypropyl(methyl)carbamoyl]phenyl]-6-[2-(4-sulfophenyl)ethylamino]xanthen-3-ylidene]-[2-(4-sulfophenyl)ethyl]azanium (PubChem CID 153443735) has the molecular formula C41H40N3O10S2+ and a molecular weight of 798.92 g/mol. Its IUPAC name is [9-[2-[3-carboxypropyl(methyl)carbamoyl]phenyl]-6-[2-(4-sulfophenyl)ethylamino]xanthen-3-ylidene]-[2-(4-sulfophenyl)ethyl]azanium.
| Compound Name | [9-[2-[3-carboxypropyl(methyl)carbamoyl]phenyl]-6-[2-(4-sulfophenyl)ethylamino]xanthen-3-ylidene]-[2-(4-sulfophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 153443735 |
| Molecular Formula | C41H40N3O10S2+ |
| Molecular Weight | 798.92 g/mol |
| Exact Mass | 798.21 |
| IUPAC Name | [9-[2-[3-carboxypropyl(methyl)carbamoyl]phenyl]-6-[2-(4-sulfophenyl)ethylamino]xanthen-3-ylidene]-[2-(4-sulfophenyl)ethyl]azanium |
| SMILES | CN(CCCC(=O)O)C(=O)c1ccccc1-c1c2cc/c(=[NH+]\CCc3ccc(S(=O)(=O)O)cc3)cc-2oc2cc(NCCc3ccc(S(=O)(=O)O)cc3)ccc12 |
| InChI | InChI=1S/C41H39N3O10S2/c1-44(24-4-7-39(45)46)41(47)34-6-3-2-5-33(34)40-35-18-12-29(42-22-20-27-8-14-31(15-9-27)55(48,49)50)25-37(35)54-38-26-30(13-19-36(38)40)43-23-21-28-10-16-32(17-11-28)56(51,52)53/h2-3,5-6,8-19,25-26,42H,4,7,20-24H2,1H3,(H,45,46)(H,48,49,50)(H,51,52,53)/p+1/b43-30+ |
| InChIKey | QGQGXORWTNQGKJ-BJSJXSMNSA-O |
| XLogP | 4.51 |
| TPSA | 205.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.92 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|