C40H37N3O13S3 — CID 162054143
9-[2-[(4-methoxy-4-oxobutyl)-methylcarbamoyl]phenyl]-6-[(2-sulfophenyl)methylamino]-3-[(4-sulfophenyl)methylimino]xanthene-2-sulfonic acid (PubChem CID 162054143) has the molecular formula C40H37N3O13S3 and a molecular weight of 863.94 g/mol. Its IUPAC name is 9-[2-[(4-methoxy-4-oxobutyl)-methylcarbamoyl]phenyl]-6-[(2-sulfophenyl)methylamino]-3-[(4-sulfophenyl)methylimino]xanthene-2-sulfonic acid.
| Compound Name | 9-[2-[(4-methoxy-4-oxobutyl)-methylcarbamoyl]phenyl]-6-[(2-sulfophenyl)methylamino]-3-[(4-sulfophenyl)methylimino]xanthene-2-sulfonic acid |
|---|---|
| PubChem CID | 162054143 |
| Molecular Formula | C40H37N3O13S3 |
| Molecular Weight | 863.94 g/mol |
| Exact Mass | 863.15 |
| IUPAC Name | 9-[2-[(4-methoxy-4-oxobutyl)-methylcarbamoyl]phenyl]-6-[(2-sulfophenyl)methylamino]-3-[(4-sulfophenyl)methylimino]xanthene-2-sulfonic acid |
| SMILES | COC(=O)CCCN(C)C(=O)c1ccccc1-c1c2cc(S(=O)(=O)O)/c(=N/Cc3ccc(S(=O)(=O)O)cc3)cc-2oc2cc(NCc3ccccc3S(=O)(=O)O)ccc12 |
| InChI | InChI=1S/C40H37N3O13S3/c1-43(19-7-12-38(44)55-2)40(45)30-10-5-4-9-29(30)39-31-18-15-27(41-24-26-8-3-6-11-36(26)58(49,50)51)20-34(31)56-35-22-33(37(21-32(35)39)59(52,53)54)42-23-25-13-16-28(17-14-25)57(46,47)48/h3-6,8-11,13-18,20-22,41H,7,12,19,23-24H2,1-2H3,(H,46,47,48)(H,49,50,51)(H,52,53,54)/b42-33+ |
| InChIKey | LTINBLKTSLDYCD-JBXJJHIASA-N |
| XLogP | 5.68 |
| TPSA | 247.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.94 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|