C37H42N4O6 — CID 90875216
(2,5-dihydroxypyrrol-1-yl) 6-[methyl-[2,3,4,5-tetradeuterio-6-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoyl]amino]hexanoate (PubChem CID 90875216) has the molecular formula C37H42N4O6 and a molecular weight of 642.79 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 6-[methyl-[2,3,4,5-tetradeuterio-6-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoyl]amino]hexanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 6-[methyl-[2,3,4,5-tetradeuterio-6-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 90875216 |
| Molecular Formula | C37H42N4O6 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 6-[methyl-[2,3,4,5-tetradeuterio-6-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoyl]amino]hexanoate |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3cc(C)/c(=N/CC)cc-3oc3cc(NCC)c(C)cc23)c(C(=O)N(C)CCCCCC(=O)On2c(O)ccc2O)c1[2H] |
| InChI | InChI=1S/C37H42N4O6/c1-6-38-29-21-31-27(19-23(29)3)36(28-20-24(4)30(39-7-2)22-32(28)46-31)25-13-10-11-14-26(25)37(45)40(5)18-12-8-9-15-35(44)47-41-33(42)16-17-34(41)43/h10-11,13-14,16-17,19-22,38,42-43H,6-9,12,15,18H2,1-5H3/b39-30+/i10D,11D,13D,14D |
| InChIKey | XLKFNJKQZDAFBC-FUOOBEOPSA-N |
| XLogP | 6.67 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|