C39H43N3O4 — CID 102005998
benzyl 6-[[2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoyl]amino]hexanoate (PubChem CID 102005998) has the molecular formula C39H43N3O4 and a molecular weight of 617.79 g/mol. Its IUPAC name is benzyl 6-[[2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoyl]amino]hexanoate.
| Compound Name | benzyl 6-[[2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 102005998 |
| Molecular Formula | C39H43N3O4 |
| Molecular Weight | 617.79 g/mol |
| Exact Mass | 617.33 |
| IUPAC Name | benzyl 6-[[2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoyl]amino]hexanoate |
| SMILES | CC/N=c1\cc2oc3cc(NCC)c(C)cc3c(-c3ccccc3C(=O)NCCCCCC(=O)OCc3ccccc3)c-2cc1C |
| InChI | InChI=1S/C39H43N3O4/c1-5-40-33-23-35-31(21-26(33)3)38(32-22-27(4)34(41-6-2)24-36(32)46-35)29-17-12-13-18-30(29)39(44)42-20-14-8-11-19-37(43)45-25-28-15-9-7-10-16-28/h7,9-10,12-13,15-18,21-24,40H,5-6,8,11,14,19-20,25H2,1-4H3,(H,42,44)/b41-34+ |
| InChIKey | WJXUTGXEHTYRES-MYGQCYSGSA-N |
| XLogP | 8.21 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.79 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|