C30H37N5O2 — CID 122174055
N-[2-(2-aminoethylamino)ethyl]-3-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzamide (PubChem CID 122174055) has the molecular formula C30H37N5O2 and a molecular weight of 499.66 g/mol. Its IUPAC name is N-[2-(2-aminoethylamino)ethyl]-3-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzamide.
| Compound Name | N-[2-(2-aminoethylamino)ethyl]-3-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzamide |
|---|---|
| PubChem CID | 122174055 |
| Molecular Formula | C30H37N5O2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | N-[2-(2-aminoethylamino)ethyl]-3-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzamide |
| SMILES | CC/N=c1\cc2oc3cc(NCC)c(C)cc3c(-c3cccc(C(=O)NCCNCCN)c3)c-2cc1C |
| InChI | InChI=1S/C30H37N5O2/c1-5-33-25-17-27-23(14-19(25)3)29(24-15-20(4)26(34-6-2)18-28(24)37-27)21-8-7-9-22(16-21)30(36)35-13-12-32-11-10-31/h7-9,14-18,32-33H,5-6,10-13,31H2,1-4H3,(H,35,36)/b34-26+ |
| InChIKey | WNBUUBIEKANZEY-JJNGWGCYSA-N |
| XLogP | 4.45 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|