C27H30N2O2 — CID 129014576
9-(2-ethoxyphenyl)-N-ethyl-6-ethylimino-2,7-dimethylxanthen-3-amine (PubChem CID 129014576) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is 9-(2-ethoxyphenyl)-N-ethyl-6-ethylimino-2,7-dimethylxanthen-3-amine.
| Compound Name | 9-(2-ethoxyphenyl)-N-ethyl-6-ethylimino-2,7-dimethylxanthen-3-amine |
|---|---|
| PubChem CID | 129014576 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 9-(2-ethoxyphenyl)-N-ethyl-6-ethylimino-2,7-dimethylxanthen-3-amine |
| SMILES | CC/N=c1\cc2oc3cc(NCC)c(C)cc3c(-c3ccccc3OCC)c-2cc1C |
| InChI | InChI=1S/C27H30N2O2/c1-6-28-22-15-25-20(13-17(22)4)27(19-11-9-10-12-24(19)30-8-3)21-14-18(5)23(29-7-2)16-26(21)31-25/h9-16,28H,6-8H2,1-5H3/b29-23+ |
| InChIKey | XJAAOCSQYWNPOF-BYNJWEBRSA-N |
| XLogP | 6.57 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|