C32H32N3O7- — CID 159685646
(2,5-dioxopyrrolidin-1-yl) acetate;2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoate (PubChem CID 159685646) has the molecular formula C32H32N3O7- and a molecular weight of 570.62 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) acetate;2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) acetate;2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 159685646 |
| Molecular Formula | C32H32N3O7- |
| Molecular Weight | 570.62 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) acetate;2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoate |
| SMILES | CC(=O)ON1C(=O)CCC1=O.CC/N=c1\cc2oc3cc(NCC)c(C)cc3c(-c3ccccc3C(=O)[O-])c-2cc1C |
| InChI | InChI=1S/C26H26N2O3.C6H7NO4/c1-5-27-21-13-23-19(11-15(21)3)25(17-9-7-8-10-18(17)26(29)30)20-12-16(4)22(28-6-2)14-24(20)31-23;1-4(8)11-7-5(9)2-3-6(7)10/h7-14,27H,5-6H2,1-4H3,(H,29,30);2-3H2,1H3/p-1/b28-22+; |
| InChIKey | MVTJWQLPBKBTIN-GVWDPOEBSA-M |
| XLogP | 4.15 |
| TPSA | 141.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.62 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|