C33H33N3O7 — CID 101338821
3-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl 2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzene-1,3-dicarboxylate (PubChem CID 101338821) has the molecular formula C33H33N3O7 and a molecular weight of 583.64 g/mol. Its IUPAC name is 3-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl 2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzene-1,3-dicarboxylate.
| Compound Name | 3-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl 2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 101338821 |
| Molecular Formula | C33H33N3O7 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | 3-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl 2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzene-1,3-dicarboxylate |
| SMILES | CC/N=c1\cc2oc3cc(NCC)c(C)cc3c(-c3c(C(=O)OCC)cccc3C(=O)ON3C(=O)CCC3=O)c-2cc1C |
| InChI | InChI=1S/C33H33N3O7/c1-6-34-24-16-26-22(14-18(24)4)31(23-15-19(5)25(35-7-2)17-27(23)42-26)30-20(32(39)41-8-3)10-9-11-21(30)33(40)43-36-28(37)12-13-29(36)38/h9-11,14-17,34H,6-8,12-13H2,1-5H3/b35-25+ |
| InChIKey | XMJTTZXDVPNZHT-KVQDIILNSA-N |
| XLogP | 5.57 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|