C28H30N2O3 — CID 56631231
2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]ethyl benzoate (PubChem CID 56631231) has the molecular formula C28H30N2O3 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]ethyl benzoate.
| Compound Name | 2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]ethyl benzoate |
|---|---|
| PubChem CID | 56631231 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]ethyl benzoate |
| SMILES | CC/N=c1\cc2oc3cc(NCC)c(C)cc3c(CCOC(=O)c3ccccc3)c-2cc1C |
| InChI | InChI=1S/C28H30N2O3/c1-5-29-24-16-26-22(14-18(24)3)21(12-13-32-28(31)20-10-8-7-9-11-20)23-15-19(4)25(30-6-2)17-27(23)33-26/h7-11,14-17,29H,5-6,12-13H2,1-4H3/b30-25+ |
| InChIKey | WPXUMNZUFGRHRV-QCWLDUFUSA-N |
| XLogP | 5.91 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|