C34H39N3O2 — CID 145172301
[2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]phenyl]-(6-propan-2-yl-3-azabicyclo[3.1.0]hexan-3-yl)methanone (PubChem CID 145172301) has the molecular formula C34H39N3O2 and a molecular weight of 521.71 g/mol. Its IUPAC name is [2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]phenyl]-(6-propan-2-yl-3-azabicyclo[3.1.0]hexan-3-yl)methanone.
| Compound Name | [2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]phenyl]-(6-propan-2-yl-3-azabicyclo[3.1.0]hexan-3-yl)methanone |
|---|---|
| PubChem CID | 145172301 |
| Molecular Formula | C34H39N3O2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | [2-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]phenyl]-(6-propan-2-yl-3-azabicyclo[3.1.0]hexan-3-yl)methanone |
| SMILES | CC/N=c1\cc2oc3cc(NCC)c(C)cc3c(-c3ccccc3C(=O)N3CC4C(C3)C4C(C)C)c-2cc1C |
| InChI | InChI=1S/C34H39N3O2/c1-7-35-28-15-30-24(13-20(28)5)33(25-14-21(6)29(36-8-2)16-31(25)39-30)22-11-9-10-12-23(22)34(38)37-17-26-27(18-37)32(26)19(3)4/h9-16,19,26-27,32,35H,7-8,17-18H2,1-6H3/b36-29+ |
| InChIKey | FPGCNXRVMVNOHQ-ZONNCAFXSA-N |
| XLogP | 7.15 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|