C27H28N2O3 — CID 102520268
methyl 2,3,4,5-tetradeuterio-6-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoate (PubChem CID 102520268) has the molecular formula C27H28N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is methyl 2,3,4,5-tetradeuterio-6-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoate.
| Compound Name | methyl 2,3,4,5-tetradeuterio-6-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 102520268 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | methyl 2,3,4,5-tetradeuterio-6-[3-(ethylamino)-6-ethylimino-2,7-dimethylxanthen-9-yl]benzoate |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c3cc(C)/c(=N/CC)cc-3oc3cc(NCC)c(C)cc23)c(C(=O)OC)c1[2H] |
| InChI | InChI=1S/C27H28N2O3/c1-6-28-22-14-24-20(12-16(22)3)26(18-10-8-9-11-19(18)27(30)31-5)21-13-17(4)23(29-7-2)15-25(21)32-24/h8-15,28H,6-7H2,1-5H3/b29-23+/i8D,9D,10D,11D |
| InChIKey | FRWVYEYQVJKWSZ-NUDGIQFLSA-N |
| XLogP | 5.96 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|