C49H52ClN5O6 — CID 138542661
[9-[2-[4-[[2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetyl]amino]butylcarbamoyl]phenyl]-6-(ethylamino)-2,7-dimethylxanthen-3-ylidene]-ethylazanium chloride (PubChem CID 138542661) has the molecular formula C49H52ClN5O6 and a molecular weight of 842.44 g/mol. Its IUPAC name is [9-[2-[4-[[2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetyl]amino]butylcarbamoyl]phenyl]-6-(ethylamino)-2,7-dimethylxanthen-3-ylidene]-ethylazanium chloride.
| Compound Name | [9-[2-[4-[[2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetyl]amino]butylcarbamoyl]phenyl]-6-(ethylamino)-2,7-dimethylxanthen-3-ylidene]-ethylazanium chloride |
|---|---|
| PubChem CID | 138542661 |
| Molecular Formula | C49H52ClN5O6 |
| Molecular Weight | 842.44 g/mol |
| Exact Mass | 841.36 |
| IUPAC Name | [9-[2-[4-[[2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetyl]amino]butylcarbamoyl]phenyl]-6-(ethylamino)-2,7-dimethylxanthen-3-ylidene]-ethylazanium chloride |
| SMILES | CCNc1cc2oc3c/c(=[NH+]\CC)c(C)cc-3c(-c3ccccc3C(=O)NCCCCNC(=O)Cc3onc(-c4ccc(OC)cc4)c3-c3ccc(OC)cc3)c2cc1C.[Cl-] |
| InChI | InChI=1S/C49H51N5O6.ClH/c1-7-50-40-27-42-38(25-30(40)3)47(39-26-31(4)41(51-8-2)28-43(39)59-42)36-13-9-10-14-37(36)49(56)53-24-12-11-23-52-45(55)29-44-46(32-15-19-34(57-5)20-16-32)48(54-60-44)33-17-21-35(58-6)22-18-33;/h9-10,13-22,25-28,50H,7-8,11-12,23-24,29H2,1-6H3,(H,52,55)(H,53,56);1H/b51-41+; |
| InChIKey | KRLPQMKKYRAUBT-GDDJTOFTSA-N |
| XLogP | 4.47 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|