C22H25N3O3 — CID 41365420
N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-2-methylbenzamide (PubChem CID 41365420) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-2-methylbenzamide.
| Compound Name | N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 41365420 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-2-methylbenzamide |
| SMILES | COc1ccc(-c2noc(CCCCCNC(=O)c3ccccc3C)n2)cc1 |
| InChI | InChI=1S/C22H25N3O3/c1-16-8-5-6-9-19(16)22(26)23-15-7-3-4-10-20-24-21(25-28-20)17-11-13-18(27-2)14-12-17/h5-6,8-9,11-14H,3-4,7,10,15H2,1-2H3,(H,23,26) |
| InChIKey | YNJSMQFIQKODKL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|