C25H26N4O4 — CID 43070312
N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide (PubChem CID 43070312) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide.
| Compound Name | N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 43070312 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]-2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide |
| SMILES | COc1ccc(-c2noc(CCCCCNC(=O)C(=O)c3c(C)[nH]c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C25H26N4O4/c1-16-22(19-8-5-6-9-20(19)27-16)23(30)25(31)26-15-7-3-4-10-21-28-24(29-33-21)17-11-13-18(32-2)14-12-17/h5-6,8-9,11-14,27H,3-4,7,10,15H2,1-2H3,(H,26,31) |
| InChIKey | ZRMITJGGTDECET-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|