C23H31N3O3 — CID 11923534
2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]acetamide (PubChem CID 11923534) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]acetamide.
| Compound Name | 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]acetamide |
|---|---|
| PubChem CID | 11923534 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 2-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]acetamide |
| SMILES | COc1ccc(-c2noc(CCCCCNC(=O)C[C@H]3C[C@H]4CC[C@@H]3C4)n2)cc1 |
| InChI | InChI=1S/C23H31N3O3/c1-28-20-10-8-17(9-11-20)23-25-22(29-26-23)5-3-2-4-12-24-21(27)15-19-14-16-6-7-18(19)13-16/h8-11,16,18-19H,2-7,12-15H2,1H3,(H,24,27)/t16-,18+,19+/m0/s1 |
| InChIKey | KWPGRPDQGRIPRI-QXAKKESOSA-N |
| XLogP | 4.40 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|