C24H33N3O2 — CID 124822684
(1R,2R,6R,7S,8R)-N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 124822684) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is (1R,2R,6R,7S,8R)-N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]tricyclo[5.2.1.02,6]decan-8-amine.
| Compound Name | (1R,2R,6R,7S,8R)-N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]tricyclo[5.2.1.02,6]decan-8-amine |
|---|---|
| PubChem CID | 124822684 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | (1R,2R,6R,7S,8R)-N-[5-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]pentyl]tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | COc1ccc(-c2noc(CCCCCN[C@@H]3C[C@H]4C[C@H]3[C@@H]3CCC[C@H]43)n2)cc1 |
| InChI | InChI=1S/C24H33N3O2/c1-28-18-11-9-16(10-12-18)24-26-23(29-27-24)8-3-2-4-13-25-22-15-17-14-21(22)20-7-5-6-19(17)20/h9-12,17,19-22,25H,2-8,13-15H2,1H3/t17-,19-,20-,21+,22-/m1/s1 |
| InChIKey | ASEXFLDCJZRTEU-OHLDOZIISA-N |
| XLogP | 4.87 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|