C33H38N2O4 — CID 87619727
methyl 6-[[2-(4,5-dideuterio-3-ethylimino-2,6,7-trimethylxanthen-9-yl)benzoyl]-methylamino]hexanoate (PubChem CID 87619727) has the molecular formula C33H38N2O4 and a molecular weight of 528.69 g/mol. Its IUPAC name is methyl 6-[[2-(4,5-dideuterio-3-ethylimino-2,6,7-trimethylxanthen-9-yl)benzoyl]-methylamino]hexanoate.
| Compound Name | methyl 6-[[2-(4,5-dideuterio-3-ethylimino-2,6,7-trimethylxanthen-9-yl)benzoyl]-methylamino]hexanoate |
|---|---|
| PubChem CID | 87619727 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | methyl 6-[[2-(4,5-dideuterio-3-ethylimino-2,6,7-trimethylxanthen-9-yl)benzoyl]-methylamino]hexanoate |
| SMILES | [2H]c1c2oc3c([2H])c(C)c(C)cc3c(-c3ccccc3C(=O)N(C)CCCCCC(=O)OC)c-2cc(C)/c1=N/CC |
| InChI | InChI=1S/C33H38N2O4/c1-7-34-28-20-30-27(18-23(28)4)32(26-17-21(2)22(3)19-29(26)39-30)24-13-10-11-14-25(24)33(37)35(5)16-12-8-9-15-31(36)38-6/h10-11,13-14,17-20H,7-9,12,15-16H2,1-6H3/b34-28+/i19D,20D |
| InChIKey | NZHDUECTBCREDD-SXBSSVEHSA-N |
| XLogP | 6.86 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|