C38H51N3O7Si — CID 136835063
ethyl 2-[3-ethylimino-6-[ethyl(3-triethoxysilylpropylcarbamoyl)amino]-2,7-dimethylxanthen-9-yl]benzoate (PubChem CID 136835063) has the molecular formula C38H51N3O7Si and a molecular weight of 689.93 g/mol. Its IUPAC name is ethyl 2-[3-ethylimino-6-[ethyl(3-triethoxysilylpropylcarbamoyl)amino]-2,7-dimethylxanthen-9-yl]benzoate.
| Compound Name | ethyl 2-[3-ethylimino-6-[ethyl(3-triethoxysilylpropylcarbamoyl)amino]-2,7-dimethylxanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 136835063 |
| Molecular Formula | C38H51N3O7Si |
| Molecular Weight | 689.93 g/mol |
| Exact Mass | 689.35 |
| IUPAC Name | ethyl 2-[3-ethylimino-6-[ethyl(3-triethoxysilylpropylcarbamoyl)amino]-2,7-dimethylxanthen-9-yl]benzoate |
| SMILES | CC/N=c1\cc2oc3cc(N(CC)C(=O)NCCC[Si](OCC)(OCC)OCC)c(C)cc3c(-c3ccccc3C(=O)OCC)c-2cc1C |
| InChI | InChI=1S/C38H51N3O7Si/c1-9-39-32-24-34-30(22-26(32)7)36(28-18-15-16-19-29(28)37(42)44-11-3)31-23-27(8)33(25-35(31)48-34)41(10-2)38(43)40-20-17-21-49(45-12-4,46-13-5)47-14-6/h15-16,18-19,22-25H,9-14,17,20-21H2,1-8H3,(H,40,43)/b39-32+ |
| InChIKey | XIKFXVKBTYPNMX-LETMKSKHSA-N |
| XLogP | 7.89 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.93 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|