C33H37N3O9S2 — CID 170260901
3-[[9-[2-(4-acetylpiperidine-1-carbonyl)phenyl]-6-(3-sulfopropylimino)xanthen-3-yl]amino]propane-1-sulfonic acid (PubChem CID 170260901) has the molecular formula C33H37N3O9S2 and a molecular weight of 683.81 g/mol. Its IUPAC name is 3-[[9-[2-(4-acetylpiperidine-1-carbonyl)phenyl]-6-(3-sulfopropylimino)xanthen-3-yl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[9-[2-(4-acetylpiperidine-1-carbonyl)phenyl]-6-(3-sulfopropylimino)xanthen-3-yl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 170260901 |
| Molecular Formula | C33H37N3O9S2 |
| Molecular Weight | 683.81 g/mol |
| Exact Mass | 683.20 |
| IUPAC Name | 3-[[9-[2-(4-acetylpiperidine-1-carbonyl)phenyl]-6-(3-sulfopropylimino)xanthen-3-yl]amino]propane-1-sulfonic acid |
| SMILES | CC(=O)C1CCN(C(=O)c2ccccc2-c2c3cc/c(=N\CCCS(=O)(=O)O)cc-3oc3cc(NCCCS(=O)(=O)O)ccc23)CC1 |
| InChI | InChI=1S/C33H37N3O9S2/c1-22(37)23-12-16-36(17-13-23)33(38)27-7-3-2-6-26(27)32-28-10-8-24(34-14-4-18-46(39,40)41)20-30(28)45-31-21-25(9-11-29(31)32)35-15-5-19-47(42,43)44/h2-3,6-11,20-21,23,34H,4-5,12-19H2,1H3,(H,39,40,41)(H,42,43,44)/b35-25+ |
| InChIKey | YCGHEKKTOAKCML-KVQDIILNSA-N |
| XLogP | 4.51 |
| TPSA | 183.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.81 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|