C37H45N5O4 — CID 90382296
1-[2-[3-(4-methylpiperazin-1-yl)-6-[2-[methyl(propyl)amino]ethylimino]xanthen-9-yl]benzoyl]piperidine-4-carboxylic acid (PubChem CID 90382296) has the molecular formula C37H45N5O4 and a molecular weight of 623.80 g/mol. Its IUPAC name is 1-[2-[3-(4-methylpiperazin-1-yl)-6-[2-[methyl(propyl)amino]ethylimino]xanthen-9-yl]benzoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[3-(4-methylpiperazin-1-yl)-6-[2-[methyl(propyl)amino]ethylimino]xanthen-9-yl]benzoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 90382296 |
| Molecular Formula | C37H45N5O4 |
| Molecular Weight | 623.80 g/mol |
| Exact Mass | 623.35 |
| IUPAC Name | 1-[2-[3-(4-methylpiperazin-1-yl)-6-[2-[methyl(propyl)amino]ethylimino]xanthen-9-yl]benzoyl]piperidine-4-carboxylic acid |
| SMILES | CCCN(C)CC/N=c1\ccc2c(-c3ccccc3C(=O)N3CCC(C(=O)O)CC3)c3ccc(N4CCN(C)CC4)cc3oc-2c1 |
| InChI | InChI=1S/C37H45N5O4/c1-4-16-39(2)19-15-38-27-9-11-31-33(24-27)46-34-25-28(41-22-20-40(3)21-23-41)10-12-32(34)35(31)29-7-5-6-8-30(29)36(43)42-17-13-26(14-18-42)37(44)45/h5-12,24-26H,4,13-23H2,1-3H3,(H,44,45)/b38-27+ |
| InChIKey | GRVWFFLHZQWMAE-ACPRRRJJSA-N |
| XLogP | 5.14 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.80 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|