C29H33N3O6S — CID 143286886
1-[4,5-diamino-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]piperidine-4-carboxylic acid;ethane;methanethiol (PubChem CID 143286886) has the molecular formula C29H33N3O6S and a molecular weight of 551.67 g/mol. Its IUPAC name is 1-[4,5-diamino-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]piperidine-4-carboxylic acid;ethane;methanethiol.
| Compound Name | 1-[4,5-diamino-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]piperidine-4-carboxylic acid;ethane;methanethiol |
|---|---|
| PubChem CID | 143286886 |
| Molecular Formula | C29H33N3O6S |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 1-[4,5-diamino-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoyl]piperidine-4-carboxylic acid;ethane;methanethiol |
| SMILES | CC.CS.Nc1cc(C(=O)N2CCC(C(=O)O)CC2)c(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)cc1N |
| InChI | InChI=1S/C26H23N3O6.C2H6.CH4S/c27-20-11-18(19(12-21(20)28)25(32)29-7-5-13(6-8-29)26(33)34)24-16-3-1-14(30)9-22(16)35-23-10-15(31)2-4-17(23)24;2*1-2/h1-4,9-13,30H,5-8,27-28H2,(H,33,34);1-2H3;2H,1H3 |
| InChIKey | CFLSANFHMAMTGA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 160.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|