C39H39N4O7+ — CID 166026334
2-[3-(azetidin-1-yl)-6-[3-[[4-[ethyl-(2-methoxy-2-oxoethyl)amino]-3-methoxyphenyl]carbamoyl]azetidin-1-ium-1-ylidene]xanthen-9-yl]benzoic acid (PubChem CID 166026334) has the molecular formula C39H39N4O7+ and a molecular weight of 675.76 g/mol. Its IUPAC name is 2-[3-(azetidin-1-yl)-6-[3-[[4-[ethyl-(2-methoxy-2-oxoethyl)amino]-3-methoxyphenyl]carbamoyl]azetidin-1-ium-1-ylidene]xanthen-9-yl]benzoic acid.
| Compound Name | 2-[3-(azetidin-1-yl)-6-[3-[[4-[ethyl-(2-methoxy-2-oxoethyl)amino]-3-methoxyphenyl]carbamoyl]azetidin-1-ium-1-ylidene]xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 166026334 |
| Molecular Formula | C39H39N4O7+ |
| Molecular Weight | 675.76 g/mol |
| Exact Mass | 675.28 |
| IUPAC Name | 2-[3-(azetidin-1-yl)-6-[3-[[4-[ethyl-(2-methoxy-2-oxoethyl)amino]-3-methoxyphenyl]carbamoyl]azetidin-1-ium-1-ylidene]xanthen-9-yl]benzoic acid |
| SMILES | CCN(CC(=O)OC)c1ccc(NC(=O)C2C[N+](=c3ccc4c(-c5ccccc5C(=O)O)c5ccc(N6CCC6)cc5oc-4c3)C2)cc1OC |
| InChI | InChI=1S/C39H38N4O7/c1-4-41(23-36(44)49-3)32-15-10-25(18-35(32)48-2)40-38(45)24-21-43(22-24)27-12-14-31-34(20-27)50-33-19-26(42-16-7-17-42)11-13-30(33)37(31)28-8-5-6-9-29(28)39(46)47/h5-6,8-15,18-20,24H,4,7,16-17,21-23H2,1-3H3,(H-,40,45,46,47)/p+1 |
| InChIKey | HDQRJEQIFLBEHV-UHFFFAOYSA-O |
| XLogP | 5.16 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.76 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|