C32H30N2O7 — CID 140772589
2-[3-[3-(2-methoxy-2-oxoethyl)azetidin-1-ium-1-ylidene]-6-[3-(2-methoxy-2-oxoethyl)azetidin-1-yl]xanthen-9-yl]benzoate (PubChem CID 140772589) has the molecular formula C32H30N2O7 and a molecular weight of 554.60 g/mol. Its IUPAC name is 2-[3-[3-(2-methoxy-2-oxoethyl)azetidin-1-ium-1-ylidene]-6-[3-(2-methoxy-2-oxoethyl)azetidin-1-yl]xanthen-9-yl]benzoate.
| Compound Name | 2-[3-[3-(2-methoxy-2-oxoethyl)azetidin-1-ium-1-ylidene]-6-[3-(2-methoxy-2-oxoethyl)azetidin-1-yl]xanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 140772589 |
| Molecular Formula | C32H30N2O7 |
| Molecular Weight | 554.60 g/mol |
| Exact Mass | 554.21 |
| IUPAC Name | 2-[3-[3-(2-methoxy-2-oxoethyl)azetidin-1-ium-1-ylidene]-6-[3-(2-methoxy-2-oxoethyl)azetidin-1-yl]xanthen-9-yl]benzoate |
| SMILES | COC(=O)CC1CN(c2ccc3c(-c4ccccc4C(=O)[O-])c4ccc(=[N+]5CC(CC(=O)OC)C5)cc-4oc3c2)C1 |
| InChI | InChI=1S/C32H30N2O7/c1-39-29(35)11-19-15-33(16-19)21-7-9-25-27(13-21)41-28-14-22(34-17-20(18-34)12-30(36)40-2)8-10-26(28)31(25)23-5-3-4-6-24(23)32(37)38/h3-10,13-14,19-20H,11-12,15-18H2,1-2H3 |
| InChIKey | GZHHLNAUIXPCBB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 112.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|