C26H17F6N2O3+ — CID 162450245
2,3,4,5-tetrafluoro-6-[3-(3-fluoroazetidin-1-ium-1-ylidene)-6-(3-fluoroazetidin-1-yl)xanthen-9-yl]benzoic acid (PubChem CID 162450245) has the molecular formula C26H17F6N2O3+ and a molecular weight of 519.42 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-[3-(3-fluoroazetidin-1-ium-1-ylidene)-6-(3-fluoroazetidin-1-yl)xanthen-9-yl]benzoic acid.
| Compound Name | 2,3,4,5-tetrafluoro-6-[3-(3-fluoroazetidin-1-ium-1-ylidene)-6-(3-fluoroazetidin-1-yl)xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 162450245 |
| Molecular Formula | C26H17F6N2O3+ |
| Molecular Weight | 519.42 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-[3-(3-fluoroazetidin-1-ium-1-ylidene)-6-(3-fluoroazetidin-1-yl)xanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1c(F)c(F)c(F)c(F)c1-c1c2ccc(=[N+]3CC(F)C3)cc-2oc2cc(N3CC(F)C3)ccc12 |
| InChI | InChI=1S/C26H16F6N2O3/c27-11-7-33(8-11)13-1-3-15-17(5-13)37-18-6-14(34-9-12(28)10-34)2-4-16(18)19(15)20-21(26(35)36)23(30)25(32)24(31)22(20)29/h1-6,11-12H,7-10H2/p+1 |
| InChIKey | HEPVANBGWFRGBL-UHFFFAOYSA-O |
| XLogP | 4.74 |
| TPSA | 56.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|