C26H22N2O3 — CID 151007000
2-[3-(2,2,3,3,4,4-hexadeuterioazetidin-1-ium-1-ylidene)-6-(2,2,3,3,4,4-hexadeuterioazetidin-1-yl)xanthen-9-yl]benzoate (PubChem CID 151007000) has the molecular formula C26H22N2O3 and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-[3-(2,2,3,3,4,4-hexadeuterioazetidin-1-ium-1-ylidene)-6-(2,2,3,3,4,4-hexadeuterioazetidin-1-yl)xanthen-9-yl]benzoate.
| Compound Name | 2-[3-(2,2,3,3,4,4-hexadeuterioazetidin-1-ium-1-ylidene)-6-(2,2,3,3,4,4-hexadeuterioazetidin-1-yl)xanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 151007000 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 2-[3-(2,2,3,3,4,4-hexadeuterioazetidin-1-ium-1-ylidene)-6-(2,2,3,3,4,4-hexadeuterioazetidin-1-yl)xanthen-9-yl]benzoate |
| SMILES | [2H]C1([2H])N(c2ccc3c(-c4ccccc4C(=O)[O-])c4ccc(=[N+]5C([2H])([2H])C([2H])([2H])C5([2H])[2H])cc-4oc3c2)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C26H22N2O3/c29-26(30)20-6-2-1-5-19(20)25-21-9-7-17(27-11-3-12-27)15-23(21)31-24-16-18(8-10-22(24)25)28-13-4-14-28/h1-2,5-10,15-16H,3-4,11-14H2/i3D2,4D2,11D2,12D2,13D2,14D2 |
| InChIKey | LVHKBPQDBYFYOH-SOFAOZKJSA-N |
| XLogP | 2.95 |
| TPSA | 59.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|