C30H32N4O3 — CID 172827740
4-[3-(4-methylpiperazin-1-ium-1-ylidene)-6-(4-methylpiperazin-1-yl)xanthen-9-yl]benzoate (PubChem CID 172827740) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is 4-[3-(4-methylpiperazin-1-ium-1-ylidene)-6-(4-methylpiperazin-1-yl)xanthen-9-yl]benzoate.
| Compound Name | 4-[3-(4-methylpiperazin-1-ium-1-ylidene)-6-(4-methylpiperazin-1-yl)xanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 172827740 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 4-[3-(4-methylpiperazin-1-ium-1-ylidene)-6-(4-methylpiperazin-1-yl)xanthen-9-yl]benzoate |
| SMILES | CN1CCN(c2ccc3c(-c4ccc(C(=O)[O-])cc4)c4ccc(=[N+]5CCN(C)CC5)cc-4oc3c2)CC1 |
| InChI | InChI=1S/C30H32N4O3/c1-31-11-15-33(16-12-31)23-7-9-25-27(19-23)37-28-20-24(34-17-13-32(2)14-18-34)8-10-26(28)29(25)21-3-5-22(6-4-21)30(35)36/h3-10,19-20H,11-18H2,1-2H3 |
| InChIKey | VCGCNAJAXPNQEX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|