C39H48IN4O5+ — CID 25139927
tert-butyl 2-[4-[9-(4-iodophenyl)-6-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]piperazin-1-ium-1-ylidene]xanthen-3-yl]piperazin-1-yl]acetate (PubChem CID 25139927) has the molecular formula C39H48IN4O5+ and a molecular weight of 779.74 g/mol. Its IUPAC name is tert-butyl 2-[4-[9-(4-iodophenyl)-6-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]piperazin-1-ium-1-ylidene]xanthen-3-yl]piperazin-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[9-(4-iodophenyl)-6-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]piperazin-1-ium-1-ylidene]xanthen-3-yl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 25139927 |
| Molecular Formula | C39H48IN4O5+ |
| Molecular Weight | 779.74 g/mol |
| Exact Mass | 779.27 |
| IUPAC Name | tert-butyl 2-[4-[9-(4-iodophenyl)-6-[4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]piperazin-1-ium-1-ylidene]xanthen-3-yl]piperazin-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(c2ccc3c(-c4ccc(I)cc4)c4ccc(=[N+]5CCN(CC(=O)OC(C)(C)C)CC5)cc-4oc3c2)CC1 |
| InChI | InChI=1S/C39H48IN4O5/c1-38(2,3)48-35(45)25-41-15-19-43(20-16-41)29-11-13-31-33(23-29)47-34-24-30(12-14-32(34)37(31)27-7-9-28(40)10-8-27)44-21-17-42(18-22-44)26-36(46)49-39(4,5)6/h7-14,23-24H,15-22,25-26H2,1-6H3/q+1 |
| InChIKey | LFHMKHFBGJKZSZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 78.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.74 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|