C43H58N5O7+ — CID 90373938
tert-butyl 3-[2-[2-[2-[[4-[3-(4-methylpiperazin-1-ium-1-ylidene)-6-(4-methylpiperazin-1-yl)xanthen-9-yl]benzoyl]amino]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 90373938) has the molecular formula C43H58N5O7+ and a molecular weight of 756.96 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-[2-[[4-[3-(4-methylpiperazin-1-ium-1-ylidene)-6-(4-methylpiperazin-1-yl)xanthen-9-yl]benzoyl]amino]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-[2-[[4-[3-(4-methylpiperazin-1-ium-1-ylidene)-6-(4-methylpiperazin-1-yl)xanthen-9-yl]benzoyl]amino]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 90373938 |
| Molecular Formula | C43H58N5O7+ |
| Molecular Weight | 756.96 g/mol |
| Exact Mass | 756.43 |
| IUPAC Name | tert-butyl 3-[2-[2-[2-[[4-[3-(4-methylpiperazin-1-ium-1-ylidene)-6-(4-methylpiperazin-1-yl)xanthen-9-yl]benzoyl]amino]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CN1CCN(c2ccc3c(-c4ccc(C(=O)NCCOCCOCCOCCC(=O)OC(C)(C)C)cc4)c4ccc(=[N+]5CCN(C)CC5)cc-4oc3c2)CC1 |
| InChI | InChI=1S/C43H57N5O7/c1-43(2,3)55-40(49)14-24-51-26-28-53-29-27-52-25-15-44-42(50)33-8-6-32(7-9-33)41-36-12-10-34(47-20-16-45(4)17-21-47)30-38(36)54-39-31-35(11-13-37(39)41)48-22-18-46(5)19-23-48/h6-13,30-31H,14-29H2,1-5H3/p+1 |
| InChIKey | NMEQJNRFEWODPB-UHFFFAOYSA-O |
| XLogP | 4.19 |
| TPSA | 108.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.96 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|