C35H41N4O5+ — CID 91276684
1-[4-[9-(2,6-dimethoxyphenyl)-6-(4-propanoylpiperazin-1-ium-1-ylidene)xanthen-3-yl]piperazin-1-yl]propan-1-one (PubChem CID 91276684) has the molecular formula C35H41N4O5+ and a molecular weight of 597.74 g/mol. Its IUPAC name is 1-[4-[9-(2,6-dimethoxyphenyl)-6-(4-propanoylpiperazin-1-ium-1-ylidene)xanthen-3-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[9-(2,6-dimethoxyphenyl)-6-(4-propanoylpiperazin-1-ium-1-ylidene)xanthen-3-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 91276684 |
| Molecular Formula | C35H41N4O5+ |
| Molecular Weight | 597.74 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | 1-[4-[9-(2,6-dimethoxyphenyl)-6-(4-propanoylpiperazin-1-ium-1-ylidene)xanthen-3-yl]piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(c2ccc3c(-c4c(OC)cccc4OC)c4ccc(=[N+]5CCN(C(=O)CC)CC5)cc-4oc3c2)CC1 |
| InChI | InChI=1S/C35H41N4O5/c1-5-32(40)38-18-14-36(15-19-38)24-10-12-26-30(22-24)44-31-23-25(37-16-20-39(21-17-37)33(41)6-2)11-13-27(31)34(26)35-28(42-3)8-7-9-29(35)43-4/h7-13,22-23H,5-6,14-21H2,1-4H3/q+1 |
| InChIKey | ILNPOAPZHPNLDN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 78.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.74 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|