C30H25F3N2O5 — CID 162450217
2-[3-(azetidin-1-ium-1-ylidene)-6-(azetidin-1-yl)xanthen-9-yl]-4-(2-ethoxy-2-oxoethyl)-3,5,6-trifluorobenzoate (PubChem CID 162450217) has the molecular formula C30H25F3N2O5 and a molecular weight of 550.53 g/mol. Its IUPAC name is 2-[3-(azetidin-1-ium-1-ylidene)-6-(azetidin-1-yl)xanthen-9-yl]-4-(2-ethoxy-2-oxoethyl)-3,5,6-trifluorobenzoate.
| Compound Name | 2-[3-(azetidin-1-ium-1-ylidene)-6-(azetidin-1-yl)xanthen-9-yl]-4-(2-ethoxy-2-oxoethyl)-3,5,6-trifluorobenzoate |
|---|---|
| PubChem CID | 162450217 |
| Molecular Formula | C30H25F3N2O5 |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.17 |
| IUPAC Name | 2-[3-(azetidin-1-ium-1-ylidene)-6-(azetidin-1-yl)xanthen-9-yl]-4-(2-ethoxy-2-oxoethyl)-3,5,6-trifluorobenzoate |
| SMILES | CCOC(=O)Cc1c(F)c(F)c(C(=O)[O-])c(-c2c3ccc(=[N+]4CCC4)cc-3oc3cc(N4CCC4)ccc23)c1F |
| InChI | InChI=1S/C30H25F3N2O5/c1-2-39-23(36)15-20-27(31)25(26(30(37)38)29(33)28(20)32)24-18-7-5-16(34-9-3-10-34)13-21(18)40-22-14-17(6-8-19(22)24)35-11-4-12-35/h5-8,13-14H,2-4,9-12,15H2,1H3 |
| InChIKey | IWZLPCMIAPIVGA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|